Skip to content

9701 · 14.1

Alkanes — practice questions

Practice and worked examples for 9701 Alkanes. Short previews only — attempt the full question in MarkScheme against the official scheme.

Worked example 1

Butane (C4H10C_4H_{10}) undergoes complete combustion. (a) Write a balanced chemical equation for this reaction. (b) Calculate the volume of carbon dioxide produced, measured at room temperature and pressure (RTP), when 120 cm³ of butane gas is completely combusted.

Show solution outline

(a) First, balance the carbons, then hydrogens, then oxygens. C4H10(g)+O2(g)CO2(g)+H2O(l)C_4H_{10}(g) + O_2(g) \rightarrow CO_2(g) + H_2O(l) Balance C: C4H10+O24CO2+H2OC_4H_{10} + O_2 \rightarrow 4CO_2 + H_2O Balance H: C4H10+O24CO2+5H2OC_4H_{10} + O_2 \rightarrow 4CO_2 + 5H_2O Balance O: There are (4 × 2) + 5 = 13 oxygen atoms on the right. So we need 13/2 O2O_2. C4H10(g)+6.5O2(g)4CO2(g)+5H2O(l)C_4H_{10}(g) + 6.5O_2(g) \rightarrow 4CO_2(g) + 5H_2O(l) To use whole numbers: 2C4H10(g)+13O2(g)8CO2(g)+10H2O(l)2C_4H_{10}(g) + 13O_2(g) \rightarrow 8CO_2(g) + 10H_2O(l)

(b) According to Avogadro's law, the ratio of volumes of gases is equal to the ratio of their moles in the balanced equation. From the equation: 1 mole of C4H10C_4H_{10} produces 4 moles of CO2CO_2. Therefore, the volume ratio is C4H10:CO2=1:4C_4H_{10} : CO_2 = 1 : 4. Volume of CO2CO_2 = 4 × Volume of C4H10C_4H_{10} Volume of CO2CO_2 = 4 × 120 cm³ = 480 cm³. (Note: At RTP, 1 mole of any gas occupies 24 dm³ or 24000 cm³, but we can use volume ratios directly as both substances are gases).

Worked example 2

Propane reacts with bromine in the presence of UV light. Write equations for the mechanism to form 1-bromopropane (CH3CH2CH2BrCH_3CH_2CH_2Br). Include one initiation step, two propagation steps, and one possible termination step.

Show solution outline

Initiation: The Br-Br bond is broken by UV light to form two bromine radicals. Br2UV2BrBr_2 \xrightarrow{UV} 2Br\cdot

Propagation: Step 1: A bromine radical abstracts a hydrogen atom from a propane molecule to form an alkyl radical and hydrogen bromide. To form 1-bromopropane, the hydrogen must be removed from a terminal carbon. Br+CH3CH2CH3CH2CH2CH3+HBrBr\cdot + CH_3CH_2CH_3 \rightarrow \cdot CH_2CH_2CH_3 + HBr Step 2: The propyl radical reacts with a bromine molecule to form the product and a new bromine radical, which continues the chain. CH2CH2CH3+Br2CH3CH2CH2Br+Br\cdot CH_2CH_2CH_3 + Br_2 \rightarrow CH_3CH_2CH_2Br + Br\cdot

Termination: Any two radicals can combine. For example, two propyl radicals could combine. CH2CH2CH3+CH2CH2CH3CH3CH2CH2CH2CH2CH3\cdot CH_2CH_2CH_3 + \cdot CH_2CH_2CH_3 \rightarrow CH_3CH_2CH_2CH_2CH_2CH_3 (hexane)